C24H30IN11O3 — CID 18625408
2-[2-[(4-aminocyclohexyl)amino]-6-[(3-iodophenyl)methylamino]purin-9-yl]-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol (PubChem CID 18625408) has the molecular formula C24H30IN11O3 and a molecular weight of 647.48 g/mol. Its IUPAC name is 2-[2-[(4-aminocyclohexyl)amino]-6-[(3-iodophenyl)methylamino]purin-9-yl]-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol.
| Compound Name | 2-[2-[(4-aminocyclohexyl)amino]-6-[(3-iodophenyl)methylamino]purin-9-yl]-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 18625408 |
| Molecular Formula | C24H30IN11O3 |
| Molecular Weight | 647.48 g/mol |
| Exact Mass | 647.16 |
| IUPAC Name | 2-[2-[(4-aminocyclohexyl)amino]-6-[(3-iodophenyl)methylamino]purin-9-yl]-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol |
| SMILES | Cn1nnc(C2OC(n3cnc4c(NCc5cccc(I)c5)nc(NC5CCC(N)CC5)nc43)C(O)C2O)n1 |
| InChI | InChI=1S/C24H30IN11O3/c1-35-33-21(32-34-35)19-17(37)18(38)23(39-19)36-11-28-16-20(27-10-12-3-2-4-13(25)9-12)30-24(31-22(16)36)29-15-7-5-14(26)6-8-15/h2-4,9,11,14-15,17-19,23,37-38H,5-8,10,26H2,1H3,(H2,27,29,30,31) |
| InChIKey | MPJKHYRVZJKYND-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 186.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.48 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|