C34H40N8O4 — CID 70139518
(2R,3R,4R,5R)-2-[2-[(4-aminocyclohexyl)amino]-6-(2,2-diphenylethylamino)purin-9-yl]-5-(3-ethyl-1,2-oxazol-5-yl)oxolane-3,4-diol (PubChem CID 70139518) has the molecular formula C34H40N8O4 and a molecular weight of 624.75 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-[2-[(4-aminocyclohexyl)amino]-6-(2,2-diphenylethylamino)purin-9-yl]-5-(3-ethyl-1,2-oxazol-5-yl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-[2-[(4-aminocyclohexyl)amino]-6-(2,2-diphenylethylamino)purin-9-yl]-5-(3-ethyl-1,2-oxazol-5-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 70139518 |
| Molecular Formula | C34H40N8O4 |
| Molecular Weight | 624.75 g/mol |
| Exact Mass | 624.32 |
| IUPAC Name | (2R,3R,4R,5R)-2-[2-[(4-aminocyclohexyl)amino]-6-(2,2-diphenylethylamino)purin-9-yl]-5-(3-ethyl-1,2-oxazol-5-yl)oxolane-3,4-diol |
| SMILES | CCc1cc([C@@H]2O[C@@H](n3cnc4c(NCC(c5ccccc5)c5ccccc5)nc(NC5CCC(N)CC5)nc43)[C@H](O)[C@H]2O)on1 |
| InChI | InChI=1S/C34H40N8O4/c1-2-23-17-26(46-41-23)30-28(43)29(44)33(45-30)42-19-37-27-31(39-34(40-32(27)42)38-24-15-13-22(35)14-16-24)36-18-25(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-12,17,19,22,24-25,28-30,33,43-44H,2,13-16,18,35H2,1H3,(H2,36,38,39,40)/t22?,24?,28-,29-,30+,33-/m1/s1 |
| InChIKey | RKWULRTUQLOHPU-VEIWVINISA-N |
| XLogP | 4.29 |
| TPSA | 169.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.75 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |