C24H37N9O6 — CID 70020233
(2R,3R,4S,5S)-2-[2-[(4-aminocyclohexyl)amino]-6-(pentan-3-ylamino)purin-9-yl]-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolane-3,4-diol;formic acid (PubChem CID 70020233) has the molecular formula C24H37N9O6 and a molecular weight of 547.62 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[2-[(4-aminocyclohexyl)amino]-6-(pentan-3-ylamino)purin-9-yl]-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolane-3,4-diol;formic acid.
| Compound Name | (2R,3R,4S,5S)-2-[2-[(4-aminocyclohexyl)amino]-6-(pentan-3-ylamino)purin-9-yl]-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolane-3,4-diol;formic acid |
|---|---|
| PubChem CID | 70020233 |
| Molecular Formula | C24H37N9O6 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | (2R,3R,4S,5S)-2-[2-[(4-aminocyclohexyl)amino]-6-(pentan-3-ylamino)purin-9-yl]-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolane-3,4-diol;formic acid |
| SMILES | CCC(CC)Nc1nc(NC2CCC(N)CC2)nc2c1ncn2[C@@H]1O[C@H](c2nc(C)no2)[C@@H](O)[C@H]1O.O=CO |
| InChI | InChI=1S/C23H35N9O4.CH2O2/c1-4-13(5-2)27-19-15-20(30-23(29-19)28-14-8-6-12(24)7-9-14)32(10-25-15)22-17(34)16(33)18(35-22)21-26-11(3)31-36-21;2-1-3/h10,12-14,16-18,22,33-34H,4-9,24H2,1-3H3,(H2,27,28,29,30);1H,(H,2,3)/t12?,14?,16-,17+,18-,22+;/m0./s1 |
| InChIKey | QGZJXNFPTJTAKI-GPGHIUDKSA-N |
| XLogP | 1.49 |
| TPSA | 219.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|