C26H41N9O2 — CID 11720426
(1R,2S,3R,5S)-3-[2-[(4-aminocyclohexyl)amino]-6-(pentan-3-ylamino)purin-9-yl]-5-(4-ethylpyrazol-1-yl)cyclopentane-1,2-diol (PubChem CID 11720426) has the molecular formula C26H41N9O2 and a molecular weight of 511.68 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-[2-[(4-aminocyclohexyl)amino]-6-(pentan-3-ylamino)purin-9-yl]-5-(4-ethylpyrazol-1-yl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-[2-[(4-aminocyclohexyl)amino]-6-(pentan-3-ylamino)purin-9-yl]-5-(4-ethylpyrazol-1-yl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 11720426 |
| Molecular Formula | C26H41N9O2 |
| Molecular Weight | 511.68 g/mol |
| Exact Mass | 511.34 |
| IUPAC Name | (1R,2S,3R,5S)-3-[2-[(4-aminocyclohexyl)amino]-6-(pentan-3-ylamino)purin-9-yl]-5-(4-ethylpyrazol-1-yl)cyclopentane-1,2-diol |
| SMILES | CCc1cnn([C@H]2C[C@@H](n3cnc4c(NC(CC)CC)nc(NC5CCC(N)CC5)nc43)[C@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C26H41N9O2/c1-4-15-12-29-35(13-15)20-11-19(22(36)23(20)37)34-14-28-21-24(30-17(5-2)6-3)32-26(33-25(21)34)31-18-9-7-16(27)8-10-18/h12-14,16-20,22-23,36-37H,4-11,27H2,1-3H3,(H2,30,31,32,33)/t16?,18?,19-,20+,22+,23-/m1/s1 |
| InChIKey | ZHSQYBISLPXCSJ-JMWHKEHISA-N |
| XLogP | 2.78 |
| TPSA | 151.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.68 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |