C24H31N7O3 — CID 139938161
ethyl 2-[[2-[(4-aminocyclohexyl)amino]-9-(oxolan-3-yl)purin-6-yl]amino]benzoate (PubChem CID 139938161) has the molecular formula C24H31N7O3 and a molecular weight of 465.56 g/mol. Its IUPAC name is ethyl 2-[[2-[(4-aminocyclohexyl)amino]-9-(oxolan-3-yl)purin-6-yl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[(4-aminocyclohexyl)amino]-9-(oxolan-3-yl)purin-6-yl]amino]benzoate |
|---|---|
| PubChem CID | 139938161 |
| Molecular Formula | C24H31N7O3 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | ethyl 2-[[2-[(4-aminocyclohexyl)amino]-9-(oxolan-3-yl)purin-6-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1nc(NC2CCC(N)CC2)nc2c1ncn2C1CCOC1 |
| InChI | InChI=1S/C24H31N7O3/c1-2-34-23(32)18-5-3-4-6-19(18)28-21-20-22(31(14-26-20)17-11-12-33-13-17)30-24(29-21)27-16-9-7-15(25)8-10-16/h3-6,14-17H,2,7-13,25H2,1H3,(H2,27,28,29,30) |
| InChIKey | RIQFAQHMYXVKFX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 129.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |