C25H35N9O3S — CID 154490062
2-[2-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]ethylsulfamoyl]benzamide (PubChem CID 154490062) has the molecular formula C25H35N9O3S and a molecular weight of 541.68 g/mol. Its IUPAC name is 2-[2-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]ethylsulfamoyl]benzamide.
| Compound Name | 2-[2-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]ethylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 154490062 |
| Molecular Formula | C25H35N9O3S |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | 2-[2-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]ethylsulfamoyl]benzamide |
| SMILES | NC(=O)c1ccccc1S(=O)(=O)NCCNc1nc(NC2CCC(N)CC2)nc2c1ncn2C1CCCC1 |
| InChI | InChI=1S/C25H35N9O3S/c26-16-9-11-17(12-10-16)31-25-32-23(21-24(33-25)34(15-29-21)18-5-1-2-6-18)28-13-14-30-38(36,37)20-8-4-3-7-19(20)22(27)35/h3-4,7-8,15-18,30H,1-2,5-6,9-14,26H2,(H2,27,35)(H2,28,31,32,33) |
| InChIKey | SKPCBOVBONTYRT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 182.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|