C26H34N8O5 — CID 70021814
(2R,3R,4S,5S)-2-[2-[hydroxymethyl(2-phenylethyl)amino]-6-(pentan-3-ylamino)purin-9-yl]-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolane-3,4-diol (PubChem CID 70021814) has the molecular formula C26H34N8O5 and a molecular weight of 538.61 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[2-[hydroxymethyl(2-phenylethyl)amino]-6-(pentan-3-ylamino)purin-9-yl]-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-[2-[hydroxymethyl(2-phenylethyl)amino]-6-(pentan-3-ylamino)purin-9-yl]-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 70021814 |
| Molecular Formula | C26H34N8O5 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | (2R,3R,4S,5S)-2-[2-[hydroxymethyl(2-phenylethyl)amino]-6-(pentan-3-ylamino)purin-9-yl]-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolane-3,4-diol |
| SMILES | CCC(CC)Nc1nc(N(CO)CCc2ccccc2)nc2c1ncn2[C@@H]1O[C@H](c2nc(C)no2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H34N8O5/c1-4-17(5-2)29-22-18-23(31-26(30-22)33(14-35)12-11-16-9-7-6-8-10-16)34(13-27-18)25-20(37)19(36)21(38-25)24-28-15(3)32-39-24/h6-10,13,17,19-21,25,35-37H,4-5,11-12,14H2,1-3H3,(H,29,30,31)/t19-,20+,21-,25+/m0/s1 |
| InChIKey | AODNSRZKOPWLTF-UGCAPWQASA-N |
| XLogP | 2.11 |
| TPSA | 167.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|