C26H40N8O5 — CID 70140362
(2S,3S,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-5-[2-[ethyl(piperidin-1-yl)amino]-6-[(1-hydroxy-3-methylbutan-2-yl)amino]purin-9-yl]oxolane-3,4-diol (PubChem CID 70140362) has the molecular formula C26H40N8O5 and a molecular weight of 544.66 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-5-[2-[ethyl(piperidin-1-yl)amino]-6-[(1-hydroxy-3-methylbutan-2-yl)amino]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-5-[2-[ethyl(piperidin-1-yl)amino]-6-[(1-hydroxy-3-methylbutan-2-yl)amino]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 70140362 |
| Molecular Formula | C26H40N8O5 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | (2S,3S,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-5-[2-[ethyl(piperidin-1-yl)amino]-6-[(1-hydroxy-3-methylbutan-2-yl)amino]purin-9-yl]oxolane-3,4-diol |
| SMILES | CCc1cc([C@H]2O[C@@H](n3cnc4c(NC(CO)C(C)C)nc(N(CC)N5CCCCC5)nc43)[C@H](O)[C@@H]2O)on1 |
| InChI | InChI=1S/C26H40N8O5/c1-5-16-12-18(39-31-16)22-20(36)21(37)25(38-22)33-14-27-19-23(28-17(13-35)15(3)4)29-26(30-24(19)33)34(6-2)32-10-8-7-9-11-32/h12,14-15,17,20-22,25,35-37H,5-11,13H2,1-4H3,(H,28,29,30)/t17?,20-,21+,22+,25+/m0/s1 |
| InChIKey | UTSVQSCHQKTSFB-YMEPECGOSA-N |
| XLogP | 2.02 |
| TPSA | 158.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |