C27H38N8O7 — CID 91535858
[(2S,3R,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-4-formyloxy-5-[6-[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]-2-(2-pyrrolidin-1-ylethylamino)purin-9-yl]oxolan-3-yl] formate (PubChem CID 91535858) has the molecular formula C27H38N8O7 and a molecular weight of 586.65 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-4-formyloxy-5-[6-[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]-2-(2-pyrrolidin-1-ylethylamino)purin-9-yl]oxolan-3-yl] formate.
| Compound Name | [(2S,3R,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-4-formyloxy-5-[6-[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]-2-(2-pyrrolidin-1-ylethylamino)purin-9-yl]oxolan-3-yl] formate |
|---|---|
| PubChem CID | 91535858 |
| Molecular Formula | C27H38N8O7 |
| Molecular Weight | 586.65 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | [(2S,3R,4R,5R)-2-(3-ethyl-1,2-oxazol-5-yl)-4-formyloxy-5-[6-[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]-2-(2-pyrrolidin-1-ylethylamino)purin-9-yl]oxolan-3-yl] formate |
| SMILES | CCc1cc([C@H]2O[C@@H](n3cnc4c(N[C@H](CO)C(C)C)nc(NCCN5CCCC5)nc43)[C@H](OC=O)[C@@H]2OC=O)on1 |
| InChI | InChI=1S/C27H38N8O7/c1-4-17-11-19(42-33-17)21-22(39-14-37)23(40-15-38)26(41-21)35-13-29-20-24(30-18(12-36)16(2)3)31-27(32-25(20)35)28-7-10-34-8-5-6-9-34/h11,13-16,18,21-23,26,36H,4-10,12H2,1-3H3,(H2,28,30,31,32)/t18-,21-,22-,23-,26-/m1/s1 |
| InChIKey | RXYQPBXFBXZHRC-BQVKLXRGSA-N |
| XLogP | 1.67 |
| TPSA | 178.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.65 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|