C28H39N9O6 — CID 57190563
[(2S,3S,4R,5R)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-4-formyloxy-5-[6-(pentan-3-ylamino)-2-(2-piperidin-1-ylethylamino)purin-9-yl]oxolan-3-yl] formate (PubChem CID 57190563) has the molecular formula C28H39N9O6 and a molecular weight of 597.68 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-4-formyloxy-5-[6-(pentan-3-ylamino)-2-(2-piperidin-1-ylethylamino)purin-9-yl]oxolan-3-yl] formate.
| Compound Name | [(2S,3S,4R,5R)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-4-formyloxy-5-[6-(pentan-3-ylamino)-2-(2-piperidin-1-ylethylamino)purin-9-yl]oxolan-3-yl] formate |
|---|---|
| PubChem CID | 57190563 |
| Molecular Formula | C28H39N9O6 |
| Molecular Weight | 597.68 g/mol |
| Exact Mass | 597.30 |
| IUPAC Name | [(2S,3S,4R,5R)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-4-formyloxy-5-[6-(pentan-3-ylamino)-2-(2-piperidin-1-ylethylamino)purin-9-yl]oxolan-3-yl] formate |
| SMILES | CCC(CC)Nc1nc(NCCN2CCCCC2)nc2c1ncn2[C@@H]1O[C@H](c2nnc(C3CC3)o2)[C@@H](OC=O)[C@H]1OC=O |
| InChI | InChI=1S/C28H39N9O6/c1-3-18(4-2)31-23-19-24(33-28(32-23)29-10-13-36-11-6-5-7-12-36)37(14-30-19)27-22(41-16-39)20(40-15-38)21(42-27)26-35-34-25(43-26)17-8-9-17/h14-18,20-22,27H,3-13H2,1-2H3,(H2,29,31,32,33)/t20-,21+,22-,27-/m1/s1 |
| InChIKey | PYAJBXKITOBGFK-RSOWOKRSSA-N |
| XLogP | 2.94 |
| TPSA | 171.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.68 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|