C37H39N7O5 — CID 70141725
(2R,3R,4S,5S)-2-[6-(2,2-diphenylethylamino)-2-[(1-hydroxy-3-phenylpropan-2-yl)amino]purin-9-yl]-5-(3-ethyl-1,2-oxazol-5-yl)oxolane-3,4-diol (PubChem CID 70141725) has the molecular formula C37H39N7O5 and a molecular weight of 661.76 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[6-(2,2-diphenylethylamino)-2-[(1-hydroxy-3-phenylpropan-2-yl)amino]purin-9-yl]-5-(3-ethyl-1,2-oxazol-5-yl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-[6-(2,2-diphenylethylamino)-2-[(1-hydroxy-3-phenylpropan-2-yl)amino]purin-9-yl]-5-(3-ethyl-1,2-oxazol-5-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 70141725 |
| Molecular Formula | C37H39N7O5 |
| Molecular Weight | 661.76 g/mol |
| Exact Mass | 661.30 |
| IUPAC Name | (2R,3R,4S,5S)-2-[6-(2,2-diphenylethylamino)-2-[(1-hydroxy-3-phenylpropan-2-yl)amino]purin-9-yl]-5-(3-ethyl-1,2-oxazol-5-yl)oxolane-3,4-diol |
| SMILES | CCc1cc([C@H]2O[C@@H](n3cnc4c(NCC(c5ccccc5)c5ccccc5)nc(NC(CO)Cc5ccccc5)nc43)[C@H](O)[C@@H]2O)on1 |
| InChI | InChI=1S/C37H39N7O5/c1-2-26-19-29(49-43-26)33-31(46)32(47)36(48-33)44-22-39-30-34(38-20-28(24-14-8-4-9-15-24)25-16-10-5-11-17-25)41-37(42-35(30)44)40-27(21-45)18-23-12-6-3-7-13-23/h3-17,19,22,27-28,31-33,36,45-47H,2,18,20-21H2,1H3,(H2,38,40,41,42)/t27?,31-,32+,33+,36+/m0/s1 |
| InChIKey | PDXQIANKYLZHCZ-UWPDYLKSSA-N |
| XLogP | 4.63 |
| TPSA | 163.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.76 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |