C26H37N9O6 — CID 54066917
3-[[6-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-[hydroxy-(propanoylamino)methyl]oxolan-2-yl]purin-2-yl]-(2-phenylethyl)amino]-N-(2-aminoethyl)propanamide (PubChem CID 54066917) has the molecular formula C26H37N9O6 and a molecular weight of 571.64 g/mol. Its IUPAC name is 3-[[6-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-[hydroxy-(propanoylamino)methyl]oxolan-2-yl]purin-2-yl]-(2-phenylethyl)amino]-N-(2-aminoethyl)propanamide.
| Compound Name | 3-[[6-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-[hydroxy-(propanoylamino)methyl]oxolan-2-yl]purin-2-yl]-(2-phenylethyl)amino]-N-(2-aminoethyl)propanamide |
|---|---|
| PubChem CID | 54066917 |
| Molecular Formula | C26H37N9O6 |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | 3-[[6-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-[hydroxy-(propanoylamino)methyl]oxolan-2-yl]purin-2-yl]-(2-phenylethyl)amino]-N-(2-aminoethyl)propanamide |
| SMILES | CCC(=O)NC(O)[C@H]1O[C@@H](n2cnc3c(N)nc(N(CCC(=O)NCCN)CCc4ccccc4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H37N9O6/c1-2-16(36)31-24(40)21-19(38)20(39)25(41-21)35-14-30-18-22(28)32-26(33-23(18)35)34(13-9-17(37)29-11-10-27)12-8-15-6-4-3-5-7-15/h3-7,14,19-21,24-25,38-40H,2,8-13,27H2,1H3,(H,29,37)(H,31,36)(H2,28,32,33)/t19-,20+,21-,24?,25+/m0/s1 |
| InChIKey | MDQHVWOXONBVDU-HLGOXDQMSA-N |
| XLogP | -1.61 |
| TPSA | 227.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|