C12H17N5O6 — CID 10471645
(2R,3R,4R,5R)-2-(6-amino-2-methoxypurin-9-yl)-5-[(1R)-1,2-dihydroxyethyl]oxolane-3,4-diol (PubChem CID 10471645) has the molecular formula C12H17N5O6 and a molecular weight of 327.30 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(6-amino-2-methoxypurin-9-yl)-5-[(1R)-1,2-dihydroxyethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-(6-amino-2-methoxypurin-9-yl)-5-[(1R)-1,2-dihydroxyethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 10471645 |
| Molecular Formula | C12H17N5O6 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (2R,3R,4R,5R)-2-(6-amino-2-methoxypurin-9-yl)-5-[(1R)-1,2-dihydroxyethyl]oxolane-3,4-diol |
| SMILES | COc1nc(N)c2ncn([C@@H]3O[C@H]([C@H](O)CO)[C@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C12H17N5O6/c1-22-12-15-9(13)5-10(16-12)17(3-14-5)11-7(21)6(20)8(23-11)4(19)2-18/h3-4,6-8,11,18-21H,2H2,1H3,(H2,13,15,16)/t4-,6-,7-,8-,11-/m1/s1 |
| InChIKey | IEGSCXMTUHYXHX-IQUTXCMISA-N |
| XLogP | -2.61 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |