C13H19N5O3 — CID 160993196
(2R,4R,5R)-2-(6-amino-2-methylpurin-9-yl)-5-propan-2-yloxolane-3,4-diol (PubChem CID 160993196) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is (2R,4R,5R)-2-(6-amino-2-methylpurin-9-yl)-5-propan-2-yloxolane-3,4-diol.
| Compound Name | (2R,4R,5R)-2-(6-amino-2-methylpurin-9-yl)-5-propan-2-yloxolane-3,4-diol |
|---|---|
| PubChem CID | 160993196 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | (2R,4R,5R)-2-(6-amino-2-methylpurin-9-yl)-5-propan-2-yloxolane-3,4-diol |
| SMILES | Cc1nc(N)c2ncn([C@@H]3O[C@H](C(C)C)[C@H](O)C3O)c2n1 |
| InChI | InChI=1S/C13H19N5O3/c1-5(2)10-8(19)9(20)13(21-10)18-4-15-7-11(14)16-6(3)17-12(7)18/h4-5,8-10,13,19-20H,1-3H3,(H2,14,16,17)/t8-,9?,10-,13-/m1/s1 |
| InChIKey | TUXGTSGIRKFYFI-JPVQNKNJSA-N |
| XLogP | -0.01 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |