C17H25FN6O4 — CID 170271574
[(2R,3R,4S,5R)-5-(6-amino-2-methylpurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl (2R,3R)-2-amino-3-methylpentanoate (PubChem CID 170271574) has the molecular formula C17H25FN6O4 and a molecular weight of 396.42 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-(6-amino-2-methylpurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl (2R,3R)-2-amino-3-methylpentanoate.
| Compound Name | [(2R,3R,4S,5R)-5-(6-amino-2-methylpurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl (2R,3R)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 170271574 |
| Molecular Formula | C17H25FN6O4 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | [(2R,3R,4S,5R)-5-(6-amino-2-methylpurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl (2R,3R)-2-amino-3-methylpentanoate |
| SMILES | CC[C@@H](C)[C@@H](N)C(=O)OC[C@H]1O[C@@H](n2cnc3c(N)nc(C)nc32)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C17H25FN6O4/c1-4-7(2)11(19)17(26)27-5-9-13(25)10(18)16(28-9)24-6-21-12-14(20)22-8(3)23-15(12)24/h6-7,9-11,13,16,25H,4-5,19H2,1-3H3,(H2,20,22,23)/t7-,9-,10+,11-,13-,16-/m1/s1 |
| InChIKey | QRNBTGIEWDOYDM-ZKXBVZBUSA-N |
| XLogP | 0.23 |
| TPSA | 151.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |