C14H22N6O5 — CID 91141880
(2R,5R)-2-[6-amino-2-(tert-butylamino)oxypurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 91141880) has the molecular formula C14H22N6O5 and a molecular weight of 354.37 g/mol. Its IUPAC name is (2R,5R)-2-[6-amino-2-(tert-butylamino)oxypurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-[6-amino-2-(tert-butylamino)oxypurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 91141880 |
| Molecular Formula | C14H22N6O5 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (2R,5R)-2-[6-amino-2-(tert-butylamino)oxypurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC(C)(C)NOc1nc(N)c2ncn([C@@H]3O[C@H](CO)C(O)C3O)c2n1 |
| InChI | InChI=1S/C14H22N6O5/c1-14(2,3)19-25-13-17-10(15)7-11(18-13)20(5-16-7)12-9(23)8(22)6(4-21)24-12/h5-6,8-9,12,19,21-23H,4H2,1-3H3,(H2,15,17,18)/t6-,8?,9?,12-/m1/s1 |
| InChIKey | XXFAXVTXQAEGII-YEFCAQKCSA-N |
| XLogP | -1.30 |
| TPSA | 160.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|