C21H29ClN6O4 — CID 67923246
(2R,3R,4S,5R)-2-[6-amino-2-[ethyl-[(2S)-2-phenylpropyl]amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol;hydrochloride (PubChem CID 67923246) has the molecular formula C21H29ClN6O4 and a molecular weight of 464.95 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-2-[ethyl-[(2S)-2-phenylpropyl]amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol;hydrochloride.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-2-[ethyl-[(2S)-2-phenylpropyl]amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol;hydrochloride |
|---|---|
| PubChem CID | 67923246 |
| Molecular Formula | C21H29ClN6O4 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-2-[ethyl-[(2S)-2-phenylpropyl]amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol;hydrochloride |
| SMILES | CCN(C[C@@H](C)c1ccccc1)c1nc(N)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1.Cl |
| InChI | InChI=1S/C21H28N6O4.ClH/c1-3-26(9-12(2)13-7-5-4-6-8-13)21-24-18(22)15-19(25-21)27(11-23-15)20-17(30)16(29)14(10-28)31-20;/h4-8,11-12,14,16-17,20,28-30H,3,9-10H2,1-2H3,(H2,22,24,25);1H/t12-,14-,16-,17-,20-;/m1./s1 |
| InChIKey | UEEOOTOJGYYTKP-BIZXHUMVSA-N |
| XLogP | 1.07 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |