C24H31N7O8 — CID 87691561
2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-[ethoxy-[ethyl(2-phenylethyl)amino]carbamoyl]oxyacetic acid (PubChem CID 87691561) has the molecular formula C24H31N7O8 and a molecular weight of 545.55 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-[ethoxy-[ethyl(2-phenylethyl)amino]carbamoyl]oxyacetic acid.
| Compound Name | 2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-[ethoxy-[ethyl(2-phenylethyl)amino]carbamoyl]oxyacetic acid |
|---|---|
| PubChem CID | 87691561 |
| Molecular Formula | C24H31N7O8 |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-[ethoxy-[ethyl(2-phenylethyl)amino]carbamoyl]oxyacetic acid |
| SMILES | CCON(C(=O)OC(C(=O)O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)N(CC)CCc1ccccc1 |
| InChI | InChI=1S/C24H31N7O8/c1-3-29(11-10-14-8-6-5-7-9-14)31(37-4-2)24(36)39-19(23(34)35)18-16(32)17(33)22(38-18)30-13-28-15-20(25)26-12-27-21(15)30/h5-9,12-13,16-19,22,32-33H,3-4,10-11H2,1-2H3,(H,34,35)(H2,25,26,27)/t16-,17+,18-,19?,22+/m0/s1 |
| InChIKey | CBRMTRROLGHZFO-YMKPUTNUSA-N |
| XLogP | 0.35 |
| TPSA | 198.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|