C16H17N5O4S — CID 10407113
(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(benzenesulfinylmethyl)oxolane-3,4-diol (PubChem CID 10407113) has the molecular formula C16H17N5O4S and a molecular weight of 375.41 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(benzenesulfinylmethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(benzenesulfinylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 10407113 |
| Molecular Formula | C16H17N5O4S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(benzenesulfinylmethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CS(=O)c2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H17N5O4S/c17-14-11-15(19-7-18-14)21(8-20-11)16-13(23)12(22)10(25-16)6-26(24)9-4-2-1-3-5-9/h1-5,7-8,10,12-13,16,22-23H,6H2,(H2,17,18,19)/t10-,12-,13-,16-,26?/m1/s1 |
| InChIKey | FAYBLEKSWARBNP-LIQRBRLVSA-N |
| XLogP | -0.16 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |