C27H32IN11O5 — CID 91577232
[(2R,3R,4R,5R)-5-[2-[(4-aminocyclohexyl)amino]-6-[(3-iodophenyl)methylamino]purin-9-yl]-2-(2-ethyltetrazol-5-yl)-4-formyloxyoxolan-3-yl] formate (PubChem CID 91577232) has the molecular formula C27H32IN11O5 and a molecular weight of 717.53 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-[2-[(4-aminocyclohexyl)amino]-6-[(3-iodophenyl)methylamino]purin-9-yl]-2-(2-ethyltetrazol-5-yl)-4-formyloxyoxolan-3-yl] formate.
| Compound Name | [(2R,3R,4R,5R)-5-[2-[(4-aminocyclohexyl)amino]-6-[(3-iodophenyl)methylamino]purin-9-yl]-2-(2-ethyltetrazol-5-yl)-4-formyloxyoxolan-3-yl] formate |
|---|---|
| PubChem CID | 91577232 |
| Molecular Formula | C27H32IN11O5 |
| Molecular Weight | 717.53 g/mol |
| Exact Mass | 717.16 |
| IUPAC Name | [(2R,3R,4R,5R)-5-[2-[(4-aminocyclohexyl)amino]-6-[(3-iodophenyl)methylamino]purin-9-yl]-2-(2-ethyltetrazol-5-yl)-4-formyloxyoxolan-3-yl] formate |
| SMILES | CCn1nnc([C@H]2O[C@@H](n3cnc4c(NCc5cccc(I)c5)nc(NC5CCC(N)CC5)nc43)[C@H](OC=O)[C@@H]2OC=O)n1 |
| InChI | InChI=1S/C27H32IN11O5/c1-2-39-36-24(35-37-39)21-20(42-13-40)22(43-14-41)26(44-21)38-12-31-19-23(30-11-15-4-3-5-16(28)10-15)33-27(34-25(19)38)32-18-8-6-17(29)7-9-18/h3-5,10,12-14,17-18,20-22,26H,2,6-9,11,29H2,1H3,(H2,30,32,33,34)/t17?,18?,20-,21+,22-,26-/m1/s1 |
| InChIKey | WADWVBVABXIDJP-XEHGWODESA-N |
| XLogP | 2.08 |
| TPSA | 199.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.53 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|