C18H18ClN5O2 — CID 46844310
(1S,2R,3S,4R,5R)-4-[6-[(3-chlorophenyl)methylamino]purin-9-yl]bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 46844310) has the molecular formula C18H18ClN5O2 and a molecular weight of 371.83 g/mol. Its IUPAC name is (1S,2R,3S,4R,5R)-4-[6-[(3-chlorophenyl)methylamino]purin-9-yl]bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1S,2R,3S,4R,5R)-4-[6-[(3-chlorophenyl)methylamino]purin-9-yl]bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 46844310 |
| Molecular Formula | C18H18ClN5O2 |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (1S,2R,3S,4R,5R)-4-[6-[(3-chlorophenyl)methylamino]purin-9-yl]bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | O[C@@H]1[C@H](O)[C@H]2C[C@H]2[C@H]1n1cnc2c(NCc3cccc(Cl)c3)ncnc21 |
| InChI | InChI=1S/C18H18ClN5O2/c19-10-3-1-2-9(4-10)6-20-17-13-18(22-7-21-17)24(8-23-13)14-11-5-12(11)15(25)16(14)26/h1-4,7-8,11-12,14-16,25-26H,5-6H2,(H,20,21,22)/t11-,12+,14-,15-,16+/m1/s1 |
| InChIKey | LMYUTZPVPBXDQP-IPQWEPCOSA-N |
| XLogP | 2.00 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |