C17H18ClN5O3S — CID 59356312
(2R,3S)-2-[2-chloro-6-[(2-methoxyphenyl)methylamino]purin-9-yl]thiolane-3,4-diol (PubChem CID 59356312) has the molecular formula C17H18ClN5O3S and a molecular weight of 407.88 g/mol. Its IUPAC name is (2R,3S)-2-[2-chloro-6-[(2-methoxyphenyl)methylamino]purin-9-yl]thiolane-3,4-diol.
| Compound Name | (2R,3S)-2-[2-chloro-6-[(2-methoxyphenyl)methylamino]purin-9-yl]thiolane-3,4-diol |
|---|---|
| PubChem CID | 59356312 |
| Molecular Formula | C17H18ClN5O3S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | (2R,3S)-2-[2-chloro-6-[(2-methoxyphenyl)methylamino]purin-9-yl]thiolane-3,4-diol |
| SMILES | COc1ccccc1CNc1nc(Cl)nc2c1ncn2[C@@H]1SCC(O)[C@@H]1O |
| InChI | InChI=1S/C17H18ClN5O3S/c1-26-11-5-3-2-4-9(11)6-19-14-12-15(22-17(18)21-14)23(8-20-12)16-13(25)10(24)7-27-16/h2-5,8,10,13,16,24-25H,6-7H2,1H3,(H,19,21,22)/t10?,13-,16+/m0/s1 |
| InChIKey | IXGMDIBYUXOUSR-ALWGXXCGSA-N |
| XLogP | 2.07 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |