C15H14ClFN6O2S — CID 170765496
(2R,3R,4S)-2-[2-chloro-6-[(6-fluoro-2-pyridinyl)methylamino]purin-9-yl]thiolane-3,4-diol (PubChem CID 170765496) has the molecular formula C15H14ClFN6O2S and a molecular weight of 396.84 g/mol. Its IUPAC name is (2R,3R,4S)-2-[2-chloro-6-[(6-fluoro-2-pyridinyl)methylamino]purin-9-yl]thiolane-3,4-diol.
| Compound Name | (2R,3R,4S)-2-[2-chloro-6-[(6-fluoro-2-pyridinyl)methylamino]purin-9-yl]thiolane-3,4-diol |
|---|---|
| PubChem CID | 170765496 |
| Molecular Formula | C15H14ClFN6O2S |
| Molecular Weight | 396.84 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | (2R,3R,4S)-2-[2-chloro-6-[(6-fluoro-2-pyridinyl)methylamino]purin-9-yl]thiolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)CS[C@H]1n1cnc2c(NCc3cccc(F)n3)nc(Cl)nc21 |
| InChI | InChI=1S/C15H14ClFN6O2S/c16-15-21-12(18-4-7-2-1-3-9(17)20-7)10-13(22-15)23(6-19-10)14-11(25)8(24)5-26-14/h1-3,6,8,11,14,24-25H,4-5H2,(H,18,21,22)/t8-,11-,14-/m1/s1 |
| InChIKey | UWGXHHHSTSFZFI-XPLICSAQSA-N |
| XLogP | 1.59 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.84 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|