C19H18FN5O2S — CID 170736205
(2R,3R,4S)-2-[6-[(3-fluorophenyl)methylamino]-2-prop-1-ynylpurin-9-yl]thiolane-3,4-diol (PubChem CID 170736205) has the molecular formula C19H18FN5O2S and a molecular weight of 399.45 g/mol. Its IUPAC name is (2R,3R,4S)-2-[6-[(3-fluorophenyl)methylamino]-2-prop-1-ynylpurin-9-yl]thiolane-3,4-diol.
| Compound Name | (2R,3R,4S)-2-[6-[(3-fluorophenyl)methylamino]-2-prop-1-ynylpurin-9-yl]thiolane-3,4-diol |
|---|---|
| PubChem CID | 170736205 |
| Molecular Formula | C19H18FN5O2S |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | (2R,3R,4S)-2-[6-[(3-fluorophenyl)methylamino]-2-prop-1-ynylpurin-9-yl]thiolane-3,4-diol |
| SMILES | CC#Cc1nc(NCc2cccc(F)c2)c2ncn([C@@H]3SC[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C19H18FN5O2S/c1-2-4-14-23-17(21-8-11-5-3-6-12(20)7-11)15-18(24-14)25(10-22-15)19-16(27)13(26)9-28-19/h3,5-7,10,13,16,19,26-27H,8-9H2,1H3,(H,21,23,24)/t13-,16-,19-/m1/s1 |
| InChIKey | AIAQCTOXRFGPNQ-VVFCZOMOSA-N |
| XLogP | 1.92 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|