C12H13ClN5O4P — CID 87384275
(1S,2S,3S,4S,5S)-4-(6-amino-2-chloropurin-9-yl)-1-(phosphorosooxymethyl)bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 87384275) has the molecular formula C12H13ClN5O4P and a molecular weight of 357.69 g/mol. Its IUPAC name is (1S,2S,3S,4S,5S)-4-(6-amino-2-chloropurin-9-yl)-1-(phosphorosooxymethyl)bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1S,2S,3S,4S,5S)-4-(6-amino-2-chloropurin-9-yl)-1-(phosphorosooxymethyl)bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 87384275 |
| Molecular Formula | C12H13ClN5O4P |
| Molecular Weight | 357.69 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | (1S,2S,3S,4S,5S)-4-(6-amino-2-chloropurin-9-yl)-1-(phosphorosooxymethyl)bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1[C@H](O)[C@@H](O)[C@@]2(COP=O)C[C@H]12 |
| InChI | InChI=1S/C12H13ClN5O4P/c13-11-16-9(14)5-10(17-11)18(3-15-5)6-4-1-12(4,2-22-23-21)8(20)7(6)19/h3-4,6-8,19-20H,1-2H2,(H2,14,16,17)/t4-,6+,7+,8-,12-/m1/s1 |
| InChIKey | MEJWSOAXNFEBHN-MONXJCNHSA-N |
| XLogP | 0.57 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.69 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|