C12H15IN5O5P — CID 88568698
[(1R,2R,3S,4R,5S)-4-(6-amino-2-iodopurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methylphosphonic acid (PubChem CID 88568698) has the molecular formula C12H15IN5O5P and a molecular weight of 467.16 g/mol. Its IUPAC name is [(1R,2R,3S,4R,5S)-4-(6-amino-2-iodopurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methylphosphonic acid.
| Compound Name | [(1R,2R,3S,4R,5S)-4-(6-amino-2-iodopurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methylphosphonic acid |
|---|---|
| PubChem CID | 88568698 |
| Molecular Formula | C12H15IN5O5P |
| Molecular Weight | 467.16 g/mol |
| Exact Mass | 466.99 |
| IUPAC Name | [(1R,2R,3S,4R,5S)-4-(6-amino-2-iodopurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methylphosphonic acid |
| SMILES | Nc1nc(I)nc2c1ncn2[C@H]1[C@H](O)[C@H](O)[C@@]2(CP(=O)(O)O)C[C@H]12 |
| InChI | InChI=1S/C12H15IN5O5P/c13-11-16-9(14)5-10(17-11)18(3-15-5)6-4-1-12(4,2-24(21,22)23)8(20)7(6)19/h3-4,6-8,19-20H,1-2H2,(H2,14,16,17)(H2,21,22,23)/t4-,6-,7+,8+,12-/m1/s1 |
| InChIKey | HNDMNFBPBZVBPM-OFVUKCMBSA-N |
| XLogP | -0.53 |
| TPSA | 167.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.16 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|