C10H10IN5O5 — CID 89169431
(2S,5R)-5-(6-amino-2-iodopurin-9-yl)-3,4-dihydroxyoxolane-2-carboxylic acid (PubChem CID 89169431) has the molecular formula C10H10IN5O5 and a molecular weight of 407.12 g/mol. Its IUPAC name is (2S,5R)-5-(6-amino-2-iodopurin-9-yl)-3,4-dihydroxyoxolane-2-carboxylic acid.
| Compound Name | (2S,5R)-5-(6-amino-2-iodopurin-9-yl)-3,4-dihydroxyoxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 89169431 |
| Molecular Formula | C10H10IN5O5 |
| Molecular Weight | 407.12 g/mol |
| Exact Mass | 406.97 |
| IUPAC Name | (2S,5R)-5-(6-amino-2-iodopurin-9-yl)-3,4-dihydroxyoxolane-2-carboxylic acid |
| SMILES | Nc1nc(I)nc2c1ncn2[C@@H]1O[C@H](C(=O)O)C(O)C1O |
| InChI | InChI=1S/C10H10IN5O5/c11-10-14-6(12)2-7(15-10)16(1-13-2)8-4(18)3(17)5(21-8)9(19)20/h1,3-5,8,17-18H,(H,19,20)(H2,12,14,15)/t3?,4?,5-,8+/m0/s1 |
| InChIKey | MYSJEXWNEICJTE-MQSNYYLBSA-N |
| XLogP | -1.28 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.12 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|