C12H15N7O4 — CID 58178631
1-[(2S,3S,4R,5R)-5-[6-amino-2-(2-methylidenehydrazinyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanone (PubChem CID 58178631) has the molecular formula C12H15N7O4 and a molecular weight of 321.30 g/mol. Its IUPAC name is 1-[(2S,3S,4R,5R)-5-[6-amino-2-(2-methylidenehydrazinyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanone.
| Compound Name | 1-[(2S,3S,4R,5R)-5-[6-amino-2-(2-methylidenehydrazinyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanone |
|---|---|
| PubChem CID | 58178631 |
| Molecular Formula | C12H15N7O4 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 1-[(2S,3S,4R,5R)-5-[6-amino-2-(2-methylidenehydrazinyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanone |
| SMILES | C=NNc1nc(N)c2ncn([C@@H]3O[C@H](C(C)=O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C12H15N7O4/c1-4(20)8-6(21)7(22)11(23-8)19-3-15-5-9(13)16-12(18-14-2)17-10(5)19/h3,6-8,11,21-22H,2H2,1H3,(H3,13,16,17,18)/t6-,7+,8+,11+/m0/s1 |
| InChIKey | JIVLCLOXMTXYGJ-PRKAOEEVSA-N |
| XLogP | -1.36 |
| TPSA | 160.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|