C13H19N7O4 — CID 58178638
1-[(2S,3S,4R,5R)-5-[6-(ethylamino)-2-hydrazinylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanone (PubChem CID 58178638) has the molecular formula C13H19N7O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is 1-[(2S,3S,4R,5R)-5-[6-(ethylamino)-2-hydrazinylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanone.
| Compound Name | 1-[(2S,3S,4R,5R)-5-[6-(ethylamino)-2-hydrazinylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanone |
|---|---|
| PubChem CID | 58178638 |
| Molecular Formula | C13H19N7O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-[(2S,3S,4R,5R)-5-[6-(ethylamino)-2-hydrazinylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanone |
| SMILES | CCNc1nc(NN)nc2c1ncn2[C@@H]1O[C@H](C(C)=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H19N7O4/c1-3-15-10-6-11(18-13(17-10)19-14)20(4-16-6)12-8(23)7(22)9(24-12)5(2)21/h4,7-9,12,22-23H,3,14H2,1-2H3,(H2,15,17,18,19)/t7-,8+,9+,12+/m0/s1 |
| InChIKey | LBBWIZYKQFEKCD-FNOROQBZSA-N |
| XLogP | -1.25 |
| TPSA | 160.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|