C17H21N7O5 — CID 123418727
1-[(2S,3S,4R,5R)-5-[6-amino-2-[2-(2H-pyran-5-ylidenemethyl)hydrazinyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanone (PubChem CID 123418727) has the molecular formula C17H21N7O5 and a molecular weight of 403.40 g/mol. Its IUPAC name is 1-[(2S,3S,4R,5R)-5-[6-amino-2-[2-(2H-pyran-5-ylidenemethyl)hydrazinyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanone.
| Compound Name | 1-[(2S,3S,4R,5R)-5-[6-amino-2-[2-(2H-pyran-5-ylidenemethyl)hydrazinyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanone |
|---|---|
| PubChem CID | 123418727 |
| Molecular Formula | C17H21N7O5 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-[(2S,3S,4R,5R)-5-[6-amino-2-[2-(2H-pyran-5-ylidenemethyl)hydrazinyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanone |
| SMILES | CC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(NNC=C4C=CCOC4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H21N7O5/c1-8(25)13-11(26)12(27)16(29-13)24-7-19-10-14(18)21-17(22-15(10)24)23-20-5-9-3-2-4-28-6-9/h2-3,5,7,11-13,16,20,26-27H,4,6H2,1H3,(H3,18,21,22,23)/t11-,12+,13+,16+/m0/s1 |
| InChIKey | NKUXMCXSRHNBDZ-VPWBDBDCSA-N |
| XLogP | -1.00 |
| TPSA | 169.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|