C18H21N7O5 — CID 58178621
1-[(2S,3S,4R,5R)-5-[6-amino-2-[(2E)-2-[(4,5-dimethylfuran-2-yl)methylidene]hydrazinyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanone (PubChem CID 58178621) has the molecular formula C18H21N7O5 and a molecular weight of 415.41 g/mol. Its IUPAC name is 1-[(2S,3S,4R,5R)-5-[6-amino-2-[(2E)-2-[(4,5-dimethylfuran-2-yl)methylidene]hydrazinyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanone.
| Compound Name | 1-[(2S,3S,4R,5R)-5-[6-amino-2-[(2E)-2-[(4,5-dimethylfuran-2-yl)methylidene]hydrazinyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanone |
|---|---|
| PubChem CID | 58178621 |
| Molecular Formula | C18H21N7O5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-[(2S,3S,4R,5R)-5-[6-amino-2-[(2E)-2-[(4,5-dimethylfuran-2-yl)methylidene]hydrazinyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanone |
| SMILES | CC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(N/N=C/c4cc(C)c(C)o4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H21N7O5/c1-7-4-10(29-9(7)3)5-21-24-18-22-15(19)11-16(23-18)25(6-20-11)17-13(28)12(27)14(30-17)8(2)26/h4-6,12-14,17,27-28H,1-3H3,(H3,19,22,23,24)/b21-5+/t12-,13+,14+,17+/m0/s1 |
| InChIKey | OTTDLLWCYDLOIA-BLKFHZIESA-N |
| XLogP | 0.27 |
| TPSA | 173.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|