C19H30N8O4 — CID 58085629
(2S,3S,4R,5R)-N-ethyl-5-[6-(ethylamino)-2-[(2E)-2-(3-methylbutylidene)hydrazinyl]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 58085629) has the molecular formula C19H30N8O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is (2S,3S,4R,5R)-N-ethyl-5-[6-(ethylamino)-2-[(2E)-2-(3-methylbutylidene)hydrazinyl]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-N-ethyl-5-[6-(ethylamino)-2-[(2E)-2-(3-methylbutylidene)hydrazinyl]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 58085629 |
| Molecular Formula | C19H30N8O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | (2S,3S,4R,5R)-N-ethyl-5-[6-(ethylamino)-2-[(2E)-2-(3-methylbutylidene)hydrazinyl]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCC)nc(N/N=C/CC(C)C)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H30N8O4/c1-5-20-15-11-16(25-19(24-15)26-23-8-7-10(3)4)27(9-22-11)18-13(29)12(28)14(31-18)17(30)21-6-2/h8-10,12-14,18,28-29H,5-7H2,1-4H3,(H,21,30)(H2,20,24,25,26)/b23-8+/t12-,13+,14-,18+/m0/s1 |
| InChIKey | UGETWLDBAAXJFQ-VINOMOMBSA-N |
| XLogP | 0.46 |
| TPSA | 158.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|