C22H29N5O6 — CID 21093383
5-[6-amino-2-[2-(4-tert-butyl-1-hydroxycyclohexyl)ethynyl]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxylic acid (PubChem CID 21093383) has the molecular formula C22H29N5O6 and a molecular weight of 459.50 g/mol. Its IUPAC name is 5-[6-amino-2-[2-(4-tert-butyl-1-hydroxycyclohexyl)ethynyl]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxylic acid.
| Compound Name | 5-[6-amino-2-[2-(4-tert-butyl-1-hydroxycyclohexyl)ethynyl]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 21093383 |
| Molecular Formula | C22H29N5O6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 5-[6-amino-2-[2-(4-tert-butyl-1-hydroxycyclohexyl)ethynyl]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxylic acid |
| SMILES | CC(C)(C)C1CCC(O)(C#Cc2nc(N)c3ncn(C4OC(C(=O)O)C(O)C4O)c3n2)CC1 |
| InChI | InChI=1S/C22H29N5O6/c1-21(2,3)11-4-7-22(32,8-5-11)9-6-12-25-17(23)13-18(26-12)27(10-24-13)19-15(29)14(28)16(33-19)20(30)31/h10-11,14-16,19,28-29,32H,4-5,7-8H2,1-3H3,(H,30,31)(H2,23,25,26) |
| InChIKey | OIBYPGJOFDMOHN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 176.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|