C14H18ClN4O5P — CID 46871831
2-[(1R,2S,3R,4R,5S)-4-(7-amino-5-chloroimidazo[4,5-b]pyridin-3-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]ethylphosphonic acid (PubChem CID 46871831) has the molecular formula C14H18ClN4O5P and a molecular weight of 388.75 g/mol. Its IUPAC name is 2-[(1R,2S,3R,4R,5S)-4-(7-amino-5-chloroimidazo[4,5-b]pyridin-3-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]ethylphosphonic acid.
| Compound Name | 2-[(1R,2S,3R,4R,5S)-4-(7-amino-5-chloroimidazo[4,5-b]pyridin-3-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]ethylphosphonic acid |
|---|---|
| PubChem CID | 46871831 |
| Molecular Formula | C14H18ClN4O5P |
| Molecular Weight | 388.75 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 2-[(1R,2S,3R,4R,5S)-4-(7-amino-5-chloroimidazo[4,5-b]pyridin-3-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]ethylphosphonic acid |
| SMILES | Nc1cc(Cl)nc2c1ncn2[C@H]1[C@@H](O)[C@@H](O)[C@@]2(CCP(=O)(O)O)C[C@H]12 |
| InChI | InChI=1S/C14H18ClN4O5P/c15-8-3-7(16)9-13(18-8)19(5-17-9)10-6-4-14(6,12(21)11(10)20)1-2-25(22,23)24/h3,5-6,10-12,20-21H,1-2,4H2,(H2,16,18)(H2,22,23,24)/t6-,10-,11-,12-,14+/m1/s1 |
| InChIKey | WRXCRLVOYQWDKZ-XKJVBJDYSA-N |
| XLogP | 0.52 |
| TPSA | 154.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.75 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|