C17H22ClN5O3 — CID 162735444
(1S,2R,3S,4R,5S)-4-[5-chloro-7-(ethylamino)imidazo[4,5-b]pyridin-3-yl]-N-ethyl-2,3-dihydroxybicyclo[3.1.0]hexane-1-carboxamide (PubChem CID 162735444) has the molecular formula C17H22ClN5O3 and a molecular weight of 379.85 g/mol. Its IUPAC name is (1S,2R,3S,4R,5S)-4-[5-chloro-7-(ethylamino)imidazo[4,5-b]pyridin-3-yl]-N-ethyl-2,3-dihydroxybicyclo[3.1.0]hexane-1-carboxamide.
| Compound Name | (1S,2R,3S,4R,5S)-4-[5-chloro-7-(ethylamino)imidazo[4,5-b]pyridin-3-yl]-N-ethyl-2,3-dihydroxybicyclo[3.1.0]hexane-1-carboxamide |
|---|---|
| PubChem CID | 162735444 |
| Molecular Formula | C17H22ClN5O3 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (1S,2R,3S,4R,5S)-4-[5-chloro-7-(ethylamino)imidazo[4,5-b]pyridin-3-yl]-N-ethyl-2,3-dihydroxybicyclo[3.1.0]hexane-1-carboxamide |
| SMILES | CCNC(=O)[C@@]12C[C@@H]1[C@@H](n1cnc3c(NCC)cc(Cl)nc31)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C17H22ClN5O3/c1-3-19-9-5-10(18)22-15-11(9)21-7-23(15)12-8-6-17(8,14(25)13(12)24)16(26)20-4-2/h5,7-8,12-14,24-25H,3-4,6H2,1-2H3,(H,19,22)(H,20,26)/t8-,12-,13+,14+,17+/m1/s1 |
| InChIKey | AIRKNBUEDYWZIW-RIILSCTESA-N |
| XLogP | 0.94 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|