C12H15N4O7P — CID 135598563
[(1S,2R,3S,4R,5R)-2,3-dihydroxy-4-(6-oxo-1H-purin-9-yl)-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate (PubChem CID 135598563) has the molecular formula C12H15N4O7P and a molecular weight of 358.25 g/mol. Its IUPAC name is [(1S,2R,3S,4R,5R)-2,3-dihydroxy-4-(6-oxo-1H-purin-9-yl)-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate.
| Compound Name | [(1S,2R,3S,4R,5R)-2,3-dihydroxy-4-(6-oxo-1H-purin-9-yl)-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 135598563 |
| Molecular Formula | C12H15N4O7P |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | [(1S,2R,3S,4R,5R)-2,3-dihydroxy-4-(6-oxo-1H-purin-9-yl)-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate |
| SMILES | O=c1[nH]cnc2c1ncn2[C@H]1[C@H](O)[C@H](O)[C@@]2(COP(=O)(O)O)C[C@@H]12 |
| InChI | InChI=1S/C12H15N4O7P/c17-8-7(16-4-15-6-10(16)13-3-14-11(6)19)5-1-12(5,9(8)18)2-23-24(20,21)22/h3-5,7-9,17-18H,1-2H2,(H,13,14,19)(H2,20,21,22)/t5-,7+,8-,9-,12+/m0/s1 |
| InChIKey | WGWDMWZYYJSDFQ-GXXCTWPXSA-N |
| XLogP | -1.49 |
| TPSA | 170.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|