C13H17ClN5O5P — CID 176684997
[(1R,3R,4R,5S)-4-(6-amino-2-chloropurin-9-yl)-3-hydroxy-1-bicyclo[3.2.0]heptanyl]methyl dihydrogen phosphate (PubChem CID 176684997) has the molecular formula C13H17ClN5O5P and a molecular weight of 389.74 g/mol. Its IUPAC name is [(1R,3R,4R,5S)-4-(6-amino-2-chloropurin-9-yl)-3-hydroxy-1-bicyclo[3.2.0]heptanyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,3R,4R,5S)-4-(6-amino-2-chloropurin-9-yl)-3-hydroxy-1-bicyclo[3.2.0]heptanyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 176684997 |
| Molecular Formula | C13H17ClN5O5P |
| Molecular Weight | 389.74 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | [(1R,3R,4R,5S)-4-(6-amino-2-chloropurin-9-yl)-3-hydroxy-1-bicyclo[3.2.0]heptanyl]methyl dihydrogen phosphate |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@H]1[C@H](O)C[C@]2(COP(=O)(O)O)CC[C@H]12 |
| InChI | InChI=1S/C13H17ClN5O5P/c14-12-17-10(15)8-11(18-12)19(5-16-8)9-6-1-2-13(6,3-7(9)20)4-24-25(21,22)23/h5-7,9,20H,1-4H2,(H2,15,17,18)(H2,21,22,23)/t6-,7-,9-,13+/m1/s1 |
| InChIKey | HGUHHHZZJCUWNO-UHXVNSHHSA-N |
| XLogP | 0.87 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.74 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|