C12H15ClN5O6P — CID 58414275
[(1S,2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate (PubChem CID 58414275) has the molecular formula C12H15ClN5O6P and a molecular weight of 391.71 g/mol. Its IUPAC name is [(1S,2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate.
| Compound Name | [(1S,2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 58414275 |
| Molecular Formula | C12H15ClN5O6P |
| Molecular Weight | 391.71 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | [(1S,2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@]12C[C@H](O)[C@H](O)[C@@]1(COP(=O)(O)O)C2 |
| InChI | InChI=1S/C12H15ClN5O6P/c13-10-16-8(14)6-9(17-10)18(4-15-6)12-1-5(19)7(20)11(12,2-12)3-24-25(21,22)23/h4-5,7,19-20H,1-3H2,(H2,14,16,17)(H2,21,22,23)/t5-,7-,11-,12-/m0/s1 |
| InChIKey | XOXXXRWPOPCZLH-UAHLNWKPSA-N |
| XLogP | -0.62 |
| TPSA | 176.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.71 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|