C22H29ClN4O3 — CID 162661262
(1R,2R,3S,4R,5S)-4-[2-chloro-4-[di(cyclobutyl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl]-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 162661262) has the molecular formula C22H29ClN4O3 and a molecular weight of 432.95 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-4-[2-chloro-4-[di(cyclobutyl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl]-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1R,2R,3S,4R,5S)-4-[2-chloro-4-[di(cyclobutyl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl]-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 162661262 |
| Molecular Formula | C22H29ClN4O3 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (1R,2R,3S,4R,5S)-4-[2-chloro-4-[di(cyclobutyl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl]-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | OC[C@@]12C[C@@H]1[C@@H](n1ccc3c(NC(C4CCC4)C4CCC4)nc(Cl)nc31)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C22H29ClN4O3/c23-21-25-19(24-15(11-3-1-4-11)12-5-2-6-12)13-7-8-27(20(13)26-21)16-14-9-22(14,10-28)18(30)17(16)29/h7-8,11-12,14-18,28-30H,1-6,9-10H2,(H,24,25,26)/t14-,16-,17+,18+,22+/m1/s1 |
| InChIKey | GJSFOVRXVQVFSK-QTXLZRIBSA-N |
| XLogP | 2.74 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |