C24H24ClN5O2 — CID 163454774
(1R,2R,3S,4R,5S)-1-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-b]pyridin-1-yl)bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 163454774) has the molecular formula C24H24ClN5O2 and a molecular weight of 449.94 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-1-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-b]pyridin-1-yl)bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1R,2R,3S,4R,5S)-1-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-b]pyridin-1-yl)bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 163454774 |
| Molecular Formula | C24H24ClN5O2 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (1R,2R,3S,4R,5S)-1-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-b]pyridin-1-yl)bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | Nc1nc2cc(CC[C@@]34C[C@@H]3[C@@H](n3ccc5c(N)ccnc53)[C@H](O)[C@@H]4O)ccc2cc1Cl |
| InChI | InChI=1S/C24H24ClN5O2/c25-16-10-13-2-1-12(9-18(13)29-22(16)27)3-6-24-11-15(24)19(20(31)21(24)32)30-8-5-14-17(26)4-7-28-23(14)30/h1-2,4-5,7-10,15,19-21,31-32H,3,6,11H2,(H2,26,28)(H2,27,29)/t15-,19-,20+,21+,24-/m1/s1 |
| InChIKey | DFWPUMLGPDZYHS-OHAGCOTJSA-N |
| XLogP | 3.32 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |