C29H27FN6O2 — CID 159724447
(1S,2R,3S,4R,5S)-1-[2-[2-amino-3-(4-fluorophenyl)quinolin-7-yl]ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 159724447) has the molecular formula C29H27FN6O2 and a molecular weight of 510.57 g/mol. Its IUPAC name is (1S,2R,3S,4R,5S)-1-[2-[2-amino-3-(4-fluorophenyl)quinolin-7-yl]ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1S,2R,3S,4R,5S)-1-[2-[2-amino-3-(4-fluorophenyl)quinolin-7-yl]ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 159724447 |
| Molecular Formula | C29H27FN6O2 |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | (1S,2R,3S,4R,5S)-1-[2-[2-amino-3-(4-fluorophenyl)quinolin-7-yl]ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | Nc1nc2cc(CC[C@]34C[C@@H]3[C@@H](n3ccc5c(N)ncnc53)[C@H](O)[C@@H]4O)ccc2cc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C29H27FN6O2/c30-18-5-3-16(4-6-18)20-12-17-2-1-15(11-22(17)35-27(20)32)7-9-29-13-21(29)23(24(37)25(29)38)36-10-8-19-26(31)33-14-34-28(19)36/h1-6,8,10-12,14,21,23-25,37-38H,7,9,13H2,(H2,32,35)(H2,31,33,34)/t21-,23-,24+,25+,29+/m1/s1 |
| InChIKey | NALLKCHRLVMWBV-KQHGHGJJSA-N |
| XLogP | 3.87 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |