C24H25FN6O2 — CID 167150438
(1S,2R,3S,4R,5S)-1-[2-(2-amino-3-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.2.0]heptane-2,3-diol (PubChem CID 167150438) has the molecular formula C24H25FN6O2 and a molecular weight of 448.50 g/mol. Its IUPAC name is (1S,2R,3S,4R,5S)-1-[2-(2-amino-3-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.2.0]heptane-2,3-diol.
| Compound Name | (1S,2R,3S,4R,5S)-1-[2-(2-amino-3-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.2.0]heptane-2,3-diol |
|---|---|
| PubChem CID | 167150438 |
| Molecular Formula | C24H25FN6O2 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | (1S,2R,3S,4R,5S)-1-[2-(2-amino-3-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.2.0]heptane-2,3-diol |
| SMILES | Nc1nc2cc(CC[C@@]34CC[C@@H]3[C@@H](n3ccc5c(N)ncnc53)[C@H](O)[C@@H]4O)ccc2cc1F |
| InChI | InChI=1S/C24H25FN6O2/c25-16-10-13-2-1-12(9-17(13)30-22(16)27)3-6-24-7-4-15(24)18(19(32)20(24)33)31-8-5-14-21(26)28-11-29-23(14)31/h1-2,5,8-11,15,18-20,32-33H,3-4,6-7H2,(H2,27,30)(H2,26,28,29)/t15-,18-,19+,20+,24-/m1/s1 |
| InChIKey | KSCGKCKDUHHTRA-VGJVMQFFSA-N |
| XLogP | 2.59 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |