C23H22ClFN6O2 — CID 155668010
(1R,2R,3S,4R,5S)-1-[2-(2-amino-3-chloro-6-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 155668010) has the molecular formula C23H22ClFN6O2 and a molecular weight of 468.92 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-1-[2-(2-amino-3-chloro-6-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1R,2R,3S,4R,5S)-1-[2-(2-amino-3-chloro-6-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 155668010 |
| Molecular Formula | C23H22ClFN6O2 |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | (1R,2R,3S,4R,5S)-1-[2-(2-amino-3-chloro-6-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | Nc1nc2cc(CC[C@@]34C[C@@H]3[C@@H](n3ccc5c(N)ncnc53)[C@H](O)[C@@H]4O)c(F)cc2cc1Cl |
| InChI | InChI=1S/C23H22ClFN6O2/c24-14-5-11-6-15(25)10(7-16(11)30-21(14)27)1-3-23-8-13(23)17(18(32)19(23)33)31-4-2-12-20(26)28-9-29-22(12)31/h2,4-7,9,13,17-19,32-33H,1,3,8H2,(H2,27,30)(H2,26,28,29)/t13-,17-,18+,19+,23-/m1/s1 |
| InChIKey | HWOWUYUYQPPRNL-XNNBUEOLSA-N |
| XLogP | 2.85 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |