C24H26ClFN6 — CID 155705457
7-[2-[3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]-3-chloro-5-fluoroquinolin-2-amine;ethene (PubChem CID 155705457) has the molecular formula C24H26ClFN6 and a molecular weight of 452.97 g/mol. Its IUPAC name is 7-[2-[3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]-3-chloro-5-fluoroquinolin-2-amine;ethene.
| Compound Name | 7-[2-[3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]-3-chloro-5-fluoroquinolin-2-amine;ethene |
|---|---|
| PubChem CID | 155705457 |
| Molecular Formula | C24H26ClFN6 |
| Molecular Weight | 452.97 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 7-[2-[3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]-3-chloro-5-fluoroquinolin-2-amine;ethene |
| SMILES | C=C.Nc1nc2cc(CCC3CCC(n4ccc5c(N)ncnc54)C3)cc(F)c2cc1Cl |
| InChI | InChI=1S/C22H22ClFN6.C2H4/c23-17-10-16-18(24)8-13(9-19(16)29-21(17)26)2-1-12-3-4-14(7-12)30-6-5-15-20(25)27-11-28-22(15)30;1-2/h5-6,8-12,14H,1-4,7H2,(H2,26,29)(H2,25,27,28);1-2H2 |
| InChIKey | WCBWNJZZTYRKRB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.97 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|