C26H30N6 — CID 155362929
7-[3-[2-(2,2-dimethyl-1,3-dihydropyrrolo[2,3-b]quinolin-7-yl)ethyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 155362929) has the molecular formula C26H30N6 and a molecular weight of 426.57 g/mol. Its IUPAC name is 7-[3-[2-(2,2-dimethyl-1,3-dihydropyrrolo[2,3-b]quinolin-7-yl)ethyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[3-[2-(2,2-dimethyl-1,3-dihydropyrrolo[2,3-b]quinolin-7-yl)ethyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155362929 |
| Molecular Formula | C26H30N6 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 7-[3-[2-(2,2-dimethyl-1,3-dihydropyrrolo[2,3-b]quinolin-7-yl)ethyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC1(C)Cc2cc3ccc(CCC4CCC(n5ccc6c(N)ncnc65)C4)cc3nc2N1 |
| InChI | InChI=1S/C26H30N6/c1-26(2)14-19-13-18-7-5-17(12-22(18)30-24(19)31-26)4-3-16-6-8-20(11-16)32-10-9-21-23(27)28-15-29-25(21)32/h5,7,9-10,12-13,15-16,20H,3-4,6,8,11,14H2,1-2H3,(H,30,31)(H2,27,28,29) |
| InChIKey | XFBSBDOGKZJVPB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |