C25H28N6O — CID 138712581
7-[3-[2-[(2S)-2-methyl-3,4-dihydro-2H-[1,4]oxazino[3,2-b]quinolin-7-yl]ethyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 138712581) has the molecular formula C25H28N6O and a molecular weight of 428.54 g/mol. Its IUPAC name is 7-[3-[2-[(2S)-2-methyl-3,4-dihydro-2H-[1,4]oxazino[3,2-b]quinolin-7-yl]ethyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[3-[2-[(2S)-2-methyl-3,4-dihydro-2H-[1,4]oxazino[3,2-b]quinolin-7-yl]ethyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 138712581 |
| Molecular Formula | C25H28N6O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 7-[3-[2-[(2S)-2-methyl-3,4-dihydro-2H-[1,4]oxazino[3,2-b]quinolin-7-yl]ethyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C[C@H]1CNc2nc3cc(CCC4CCC(n5ccc6c(N)ncnc65)C4)ccc3cc2O1 |
| InChI | InChI=1S/C25H28N6O/c1-15-13-27-24-22(32-15)12-18-6-4-17(11-21(18)30-24)3-2-16-5-7-19(10-16)31-9-8-20-23(26)28-14-29-25(20)31/h4,6,8-9,11-12,14-16,19H,2-3,5,7,10,13H2,1H3,(H,27,30)(H2,26,28,29)/t15-,16?,19?/m0/s1 |
| InChIKey | IONLVURAYNDUBG-LYGPFTKASA-N |
| XLogP | 4.73 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |