C24H22ClFN6O2 — CID 138748418
(1R,2R,4S,5R)-4-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-6-methylidenebicyclo[2.1.1]hexane-1,5-diol (PubChem CID 138748418) has the molecular formula C24H22ClFN6O2 and a molecular weight of 480.93 g/mol. Its IUPAC name is (1R,2R,4S,5R)-4-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-6-methylidenebicyclo[2.1.1]hexane-1,5-diol.
| Compound Name | (1R,2R,4S,5R)-4-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-6-methylidenebicyclo[2.1.1]hexane-1,5-diol |
|---|---|
| PubChem CID | 138748418 |
| Molecular Formula | C24H22ClFN6O2 |
| Molecular Weight | 480.93 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | (1R,2R,4S,5R)-4-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-6-methylidenebicyclo[2.1.1]hexane-1,5-diol |
| SMILES | C=C1[C@]2(CCc3cc(F)c4cc(Cl)c(N)nc4c3)C[C@@H](n3ccc4c(N)ncnc43)[C@@]1(O)[C@@H]2O |
| InChI | InChI=1S/C24H22ClFN6O2/c1-11-23(4-2-12-6-16(26)14-8-15(25)20(28)31-17(14)7-12)9-18(24(11,34)22(23)33)32-5-3-13-19(27)29-10-30-21(13)32/h3,5-8,10,18,22,33-34H,1-2,4,9H2,(H2,28,31)(H2,27,29,30)/t18-,22-,23+,24-/m1/s1 |
| InChIKey | XDOMQVXSBKRHOU-LZQXYRQZSA-N |
| XLogP | 3.16 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.93 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|