C27H30ClFN6O2 — CID 167150465
2-[2-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-1-ethylcyclopent-2-en-1-yl]oxypropan-2-ol (PubChem CID 167150465) has the molecular formula C27H30ClFN6O2 and a molecular weight of 525.03 g/mol. Its IUPAC name is 2-[2-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-1-ethylcyclopent-2-en-1-yl]oxypropan-2-ol.
| Compound Name | 2-[2-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-1-ethylcyclopent-2-en-1-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 167150465 |
| Molecular Formula | C27H30ClFN6O2 |
| Molecular Weight | 525.03 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 2-[2-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-1-ethylcyclopent-2-en-1-yl]oxypropan-2-ol |
| SMILES | CCC1(OC(C)(C)O)CC(n2ccc3c(N)ncnc32)C=C1CCc1cc(F)c2cc(Cl)c(N)nc2c1 |
| InChI | InChI=1S/C27H30ClFN6O2/c1-4-27(37-26(2,3)36)13-17(35-8-7-18-23(30)32-14-33-25(18)35)11-16(27)6-5-15-9-21(29)19-12-20(28)24(31)34-22(19)10-15/h7-12,14,17,36H,4-6,13H2,1-3H3,(H2,31,34)(H2,30,32,33) |
| InChIKey | QQHHPUYLUSOWIJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.03 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|