C24H27ClFN7O2 — CID 155738682
7-[2-[3-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)cyclopenten-1-yl]ethyl]-3-chloro-5-fluoroquinolin-2-amine;propane-2,2-diol (PubChem CID 155738682) has the molecular formula C24H27ClFN7O2 and a molecular weight of 499.98 g/mol. Its IUPAC name is 7-[2-[3-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)cyclopenten-1-yl]ethyl]-3-chloro-5-fluoroquinolin-2-amine;propane-2,2-diol.
| Compound Name | 7-[2-[3-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)cyclopenten-1-yl]ethyl]-3-chloro-5-fluoroquinolin-2-amine;propane-2,2-diol |
|---|---|
| PubChem CID | 155738682 |
| Molecular Formula | C24H27ClFN7O2 |
| Molecular Weight | 499.98 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 7-[2-[3-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)cyclopenten-1-yl]ethyl]-3-chloro-5-fluoroquinolin-2-amine;propane-2,2-diol |
| SMILES | CC(C)(O)O.Nc1nc2cc(CCC3=CC(n4ncc5c(N)ncnc54)CC3)cc(F)c2cc1Cl |
| InChI | InChI=1S/C21H19ClFN7.C3H8O2/c22-16-8-14-17(23)6-12(7-18(14)29-20(16)25)2-1-11-3-4-13(5-11)30-21-15(9-28-30)19(24)26-10-27-21;1-3(2,4)5/h5-10,13H,1-4H2,(H2,25,29)(H2,24,26,27);4-5H,1-2H3 |
| InChIKey | YOOLVWOLSSSVSF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 148.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.98 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|