C23H24N6 — CID 138748501
7-[2-[3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopenten-1-yl]ethyl]-N-methylquinolin-2-amine (PubChem CID 138748501) has the molecular formula C23H24N6 and a molecular weight of 384.49 g/mol. Its IUPAC name is 7-[2-[3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopenten-1-yl]ethyl]-N-methylquinolin-2-amine.
| Compound Name | 7-[2-[3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopenten-1-yl]ethyl]-N-methylquinolin-2-amine |
|---|---|
| PubChem CID | 138748501 |
| Molecular Formula | C23H24N6 |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 7-[2-[3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopenten-1-yl]ethyl]-N-methylquinolin-2-amine |
| SMILES | CNc1ccc2ccc(CCC3=CC(n4ccc5c(N)ncnc54)CC3)cc2n1 |
| InChI | InChI=1S/C23H24N6/c1-25-21-9-7-17-6-4-16(13-20(17)28-21)3-2-15-5-8-18(12-15)29-11-10-19-22(24)26-14-27-23(19)29/h4,6-7,9-14,18H,2-3,5,8H2,1H3,(H,25,28)(H2,24,26,27) |
| InChIKey | SMPKWMFNMYGHOT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|